C10H15NO5S2 — CID 113490916
5-formyl-N-(3-methylsulfinylbutyl)furan-2-sulfonamide (PubChem CID 113490916) has the molecular formula C10H15NO5S2 and a molecular weight of 293.37 g/mol. Its IUPAC name is 5-formyl-N-(3-methylsulfinylbutyl)furan-2-sulfonamide.
| Compound Name | 5-formyl-N-(3-methylsulfinylbutyl)furan-2-sulfonamide |
|---|---|
| PubChem CID | 113490916 |
| Molecular Formula | C10H15NO5S2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 5-formyl-N-(3-methylsulfinylbutyl)furan-2-sulfonamide |
| SMILES | CC(CCNS(=O)(=O)c1ccc(C=O)o1)S(C)=O |
| InChI | InChI=1S/C10H15NO5S2/c1-8(17(2)13)5-6-11-18(14,15)10-4-3-9(7-12)16-10/h3-4,7-8,11H,5-6H2,1-2H3 |
| InChIKey | PMUIKLZBJZBNRB-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|