C12H19FN2O4S2 — CID 114626195
3-amino-5-fluoro-4-methoxy-N-(3-methylsulfinylbutyl)benzenesulfonamide (PubChem CID 114626195) has the molecular formula C12H19FN2O4S2 and a molecular weight of 338.43 g/mol. Its IUPAC name is 3-amino-5-fluoro-4-methoxy-N-(3-methylsulfinylbutyl)benzenesulfonamide.
| Compound Name | 3-amino-5-fluoro-4-methoxy-N-(3-methylsulfinylbutyl)benzenesulfonamide |
|---|---|
| PubChem CID | 114626195 |
| Molecular Formula | C12H19FN2O4S2 |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 3-amino-5-fluoro-4-methoxy-N-(3-methylsulfinylbutyl)benzenesulfonamide |
| SMILES | COc1c(N)cc(S(=O)(=O)NCCC(C)S(C)=O)cc1F |
| InChI | InChI=1S/C12H19FN2O4S2/c1-8(20(3)16)4-5-15-21(17,18)9-6-10(13)12(19-2)11(14)7-9/h6-8,15H,4-5,14H2,1-3H3 |
| InChIKey | SEUVIEQBWQZFFN-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|