C12H18FN3O4S — CID 106233682
5-[(3-amino-5-fluoro-4-methoxyphenyl)sulfonylamino]pentanamide (PubChem CID 106233682) has the molecular formula C12H18FN3O4S and a molecular weight of 319.36 g/mol. Its IUPAC name is 5-[(3-amino-5-fluoro-4-methoxyphenyl)sulfonylamino]pentanamide.
| Compound Name | 5-[(3-amino-5-fluoro-4-methoxyphenyl)sulfonylamino]pentanamide |
|---|---|
| PubChem CID | 106233682 |
| Molecular Formula | C12H18FN3O4S |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 5-[(3-amino-5-fluoro-4-methoxyphenyl)sulfonylamino]pentanamide |
| SMILES | COc1c(N)cc(S(=O)(=O)NCCCCC(N)=O)cc1F |
| InChI | InChI=1S/C12H18FN3O4S/c1-20-12-9(13)6-8(7-10(12)14)21(18,19)16-5-3-2-4-11(15)17/h6-7,16H,2-5,14H2,1H3,(H2,15,17) |
| InChIKey | LZONJHPXWQKTBO-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|