C10H12N4O4S — CID 106304253
N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-5-formylfuran-2-sulfonamide (PubChem CID 106304253) has the molecular formula C10H12N4O4S and a molecular weight of 284.30 g/mol. Its IUPAC name is N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-5-formylfuran-2-sulfonamide.
| Compound Name | N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-5-formylfuran-2-sulfonamide |
|---|---|
| PubChem CID | 106304253 |
| Molecular Formula | C10H12N4O4S |
| Molecular Weight | 284.30 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-5-formylfuran-2-sulfonamide |
| SMILES | CCn1cnnc1CNS(=O)(=O)c1ccc(C=O)o1 |
| InChI | InChI=1S/C10H12N4O4S/c1-2-14-7-11-13-9(14)5-12-19(16,17)10-4-3-8(6-15)18-10/h3-4,6-7,12H,2,5H2,1H3 |
| InChIKey | XKPQZJGINCRUFI-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 107.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.30 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|