C11H11F3N4O2S — CID 47064982
N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-2,3,4-trifluorobenzenesulfonamide (PubChem CID 47064982) has the molecular formula C11H11F3N4O2S and a molecular weight of 320.30 g/mol. Its IUPAC name is N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-2,3,4-trifluorobenzenesulfonamide.
| Compound Name | N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-2,3,4-trifluorobenzenesulfonamide |
|---|---|
| PubChem CID | 47064982 |
| Molecular Formula | C11H11F3N4O2S |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-2,3,4-trifluorobenzenesulfonamide |
| SMILES | CCn1cnnc1CNS(=O)(=O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C11H11F3N4O2S/c1-2-18-6-15-17-9(18)5-16-21(19,20)8-4-3-7(12)10(13)11(8)14/h3-4,6,16H,2,5H2,1H3 |
| InChIKey | HPTVGITWNPEQCN-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|