C11H16N6O2S — CID 114170893
N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-4-hydrazinylbenzenesulfonamide (PubChem CID 114170893) has the molecular formula C11H16N6O2S and a molecular weight of 296.36 g/mol. Its IUPAC name is N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-4-hydrazinylbenzenesulfonamide.
| Compound Name | N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-4-hydrazinylbenzenesulfonamide |
|---|---|
| PubChem CID | 114170893 |
| Molecular Formula | C11H16N6O2S |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-4-hydrazinylbenzenesulfonamide |
| SMILES | CCn1cnnc1CNS(=O)(=O)c1ccc(NN)cc1 |
| InChI | InChI=1S/C11H16N6O2S/c1-2-17-8-13-16-11(17)7-14-20(18,19)10-5-3-9(15-12)4-6-10/h3-6,8,14-15H,2,7,12H2,1H3 |
| InChIKey | APHWVKMXEPOZQZ-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 114.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|