C13H17N5O4S — CID 126812606
N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3,4-dimethyl-5-nitrobenzenesulfonamide (PubChem CID 126812606) has the molecular formula C13H17N5O4S and a molecular weight of 339.38 g/mol. Its IUPAC name is N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3,4-dimethyl-5-nitrobenzenesulfonamide.
| Compound Name | N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3,4-dimethyl-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 126812606 |
| Molecular Formula | C13H17N5O4S |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-3,4-dimethyl-5-nitrobenzenesulfonamide |
| SMILES | CCn1cnnc1CNS(=O)(=O)c1cc(C)c(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H17N5O4S/c1-4-17-8-14-16-13(17)7-15-23(21,22)11-5-9(2)10(3)12(6-11)18(19)20/h5-6,8,15H,4,7H2,1-3H3 |
| InChIKey | CZRBGGLNWOTTIS-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 120.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|