C11H13F2N5O2S — CID 106301764
5-amino-N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-2,4-difluorobenzenesulfonamide (PubChem CID 106301764) has the molecular formula C11H13F2N5O2S and a molecular weight of 317.32 g/mol. Its IUPAC name is 5-amino-N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-2,4-difluorobenzenesulfonamide.
| Compound Name | 5-amino-N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-2,4-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 106301764 |
| Molecular Formula | C11H13F2N5O2S |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 5-amino-N-[(4-ethyl-1,2,4-triazol-3-yl)methyl]-2,4-difluorobenzenesulfonamide |
| SMILES | CCn1cnnc1CNS(=O)(=O)c1cc(N)c(F)cc1F |
| InChI | InChI=1S/C11H13F2N5O2S/c1-2-18-6-15-17-11(18)5-16-21(19,20)10-4-9(14)7(12)3-8(10)13/h3-4,6,16H,2,5,14H2,1H3 |
| InChIKey | LNVNLRXKTKAYDM-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|