C11H15Br2NO3S2 — CID 115710348
2,4-dibromo-N-(3-methylsulfinylbutyl)benzenesulfonamide (PubChem CID 115710348) has the molecular formula C11H15Br2NO3S2 and a molecular weight of 433.19 g/mol. Its IUPAC name is 2,4-dibromo-N-(3-methylsulfinylbutyl)benzenesulfonamide.
| Compound Name | 2,4-dibromo-N-(3-methylsulfinylbutyl)benzenesulfonamide |
|---|---|
| PubChem CID | 115710348 |
| Molecular Formula | C11H15Br2NO3S2 |
| Molecular Weight | 433.19 g/mol |
| Exact Mass | 430.89 |
| IUPAC Name | 2,4-dibromo-N-(3-methylsulfinylbutyl)benzenesulfonamide |
| SMILES | CC(CCNS(=O)(=O)c1ccc(Br)cc1Br)S(C)=O |
| InChI | InChI=1S/C11H15Br2NO3S2/c1-8(18(2)15)5-6-14-19(16,17)11-4-3-9(12)7-10(11)13/h3-4,7-8,14H,5-6H2,1-2H3 |
| InChIKey | TUNSWVUHBRVMBO-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.19 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |