C10H13Br2NO3S2 — CID 113236203
2,4-dibromo-N-(2-ethylsulfinylethyl)benzenesulfonamide (PubChem CID 113236203) has the molecular formula C10H13Br2NO3S2 and a molecular weight of 419.16 g/mol. Its IUPAC name is 2,4-dibromo-N-(2-ethylsulfinylethyl)benzenesulfonamide.
| Compound Name | 2,4-dibromo-N-(2-ethylsulfinylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 113236203 |
| Molecular Formula | C10H13Br2NO3S2 |
| Molecular Weight | 419.16 g/mol |
| Exact Mass | 416.87 |
| IUPAC Name | 2,4-dibromo-N-(2-ethylsulfinylethyl)benzenesulfonamide |
| SMILES | CCS(=O)CCNS(=O)(=O)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C10H13Br2NO3S2/c1-2-17(14)6-5-13-18(15,16)10-4-3-8(11)7-9(10)12/h3-4,7,13H,2,5-6H2,1H3 |
| InChIKey | IVUDWVDRWSDXFP-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.16 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |