C15H23Br2N3O2S — CID 55871540
2,4-dibromo-N-[4-(4-methylpiperazin-1-yl)butyl]benzenesulfonamide (PubChem CID 55871540) has the molecular formula C15H23Br2N3O2S and a molecular weight of 469.24 g/mol. Its IUPAC name is 2,4-dibromo-N-[4-(4-methylpiperazin-1-yl)butyl]benzenesulfonamide.
| Compound Name | 2,4-dibromo-N-[4-(4-methylpiperazin-1-yl)butyl]benzenesulfonamide |
|---|---|
| PubChem CID | 55871540 |
| Molecular Formula | C15H23Br2N3O2S |
| Molecular Weight | 469.24 g/mol |
| Exact Mass | 466.99 |
| IUPAC Name | 2,4-dibromo-N-[4-(4-methylpiperazin-1-yl)butyl]benzenesulfonamide |
| SMILES | CN1CCN(CCCCNS(=O)(=O)c2ccc(Br)cc2Br)CC1 |
| InChI | InChI=1S/C15H23Br2N3O2S/c1-19-8-10-20(11-9-19)7-3-2-6-18-23(21,22)15-5-4-13(16)12-14(15)17/h4-5,12,18H,2-3,6-11H2,1H3 |
| InChIKey | CNMKBVDELZPTNQ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.24 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|