C11H15Br2N3O2S — CID 83023744
2,4-dibromo-N-(4-methylpiperazin-1-yl)benzenesulfonamide (PubChem CID 83023744) has the molecular formula C11H15Br2N3O2S and a molecular weight of 413.14 g/mol. Its IUPAC name is 2,4-dibromo-N-(4-methylpiperazin-1-yl)benzenesulfonamide.
| Compound Name | 2,4-dibromo-N-(4-methylpiperazin-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 83023744 |
| Molecular Formula | C11H15Br2N3O2S |
| Molecular Weight | 413.14 g/mol |
| Exact Mass | 410.93 |
| IUPAC Name | 2,4-dibromo-N-(4-methylpiperazin-1-yl)benzenesulfonamide |
| SMILES | CN1CCN(NS(=O)(=O)c2ccc(Br)cc2Br)CC1 |
| InChI | InChI=1S/C11H15Br2N3O2S/c1-15-4-6-16(7-5-15)14-19(17,18)11-3-2-9(12)8-10(11)13/h2-3,8,14H,4-7H2,1H3 |
| InChIKey | MRDSDOPIHWAFHC-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.14 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |