C11H19BrN4O3S — CID 106075537
2-bromo-5-(methylaminomethyl)-N-(4-methylpiperazin-1-yl)furan-3-sulfonamide (PubChem CID 106075537) has the molecular formula C11H19BrN4O3S and a molecular weight of 367.27 g/mol. Its IUPAC name is 2-bromo-5-(methylaminomethyl)-N-(4-methylpiperazin-1-yl)furan-3-sulfonamide.
| Compound Name | 2-bromo-5-(methylaminomethyl)-N-(4-methylpiperazin-1-yl)furan-3-sulfonamide |
|---|---|
| PubChem CID | 106075537 |
| Molecular Formula | C11H19BrN4O3S |
| Molecular Weight | 367.27 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | 2-bromo-5-(methylaminomethyl)-N-(4-methylpiperazin-1-yl)furan-3-sulfonamide |
| SMILES | CNCc1cc(S(=O)(=O)NN2CCN(C)CC2)c(Br)o1 |
| InChI | InChI=1S/C11H19BrN4O3S/c1-13-8-9-7-10(11(12)19-9)20(17,18)14-16-5-3-15(2)4-6-16/h7,13-14H,3-6,8H2,1-2H3 |
| InChIKey | CQRRZJXBCAPMFZ-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.27 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |