C11H14F3NO4S — CID 104600560
2,3,4-trifluoro-N-[3-(2-hydroxyethoxy)propyl]benzenesulfonamide (PubChem CID 104600560) has the molecular formula C11H14F3NO4S and a molecular weight of 313.30 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-[3-(2-hydroxyethoxy)propyl]benzenesulfonamide.
| Compound Name | 2,3,4-trifluoro-N-[3-(2-hydroxyethoxy)propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 104600560 |
| Molecular Formula | C11H14F3NO4S |
| Molecular Weight | 313.30 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | 2,3,4-trifluoro-N-[3-(2-hydroxyethoxy)propyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCCOCCO)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C11H14F3NO4S/c12-8-2-3-9(11(14)10(8)13)20(17,18)15-4-1-6-19-7-5-16/h2-3,15-16H,1,4-7H2 |
| InChIKey | MBCBILOIMVFKMY-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.30 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|