C11H14ClF2NO3S — CID 106305837
N-[3-(2-chloroethoxy)propyl]-2,5-difluorobenzenesulfonamide (PubChem CID 106305837) has the molecular formula C11H14ClF2NO3S and a molecular weight of 313.75 g/mol. Its IUPAC name is N-[3-(2-chloroethoxy)propyl]-2,5-difluorobenzenesulfonamide.
| Compound Name | N-[3-(2-chloroethoxy)propyl]-2,5-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 106305837 |
| Molecular Formula | C11H14ClF2NO3S |
| Molecular Weight | 313.75 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | N-[3-(2-chloroethoxy)propyl]-2,5-difluorobenzenesulfonamide |
| SMILES | O=S(=O)(NCCCOCCCl)c1cc(F)ccc1F |
| InChI | InChI=1S/C11H14ClF2NO3S/c12-4-7-18-6-1-5-15-19(16,17)11-8-9(13)2-3-10(11)14/h2-3,8,15H,1,4-7H2 |
| InChIKey | ONIVJEQGGWPWCU-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.75 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|