C10H13ClFNO3S — CID 110759335
5-chloro-2-fluoro-N-(3-methoxypropyl)benzenesulfonamide (PubChem CID 110759335) has the molecular formula C10H13ClFNO3S and a molecular weight of 281.74 g/mol. Its IUPAC name is 5-chloro-2-fluoro-N-(3-methoxypropyl)benzenesulfonamide.
| Compound Name | 5-chloro-2-fluoro-N-(3-methoxypropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 110759335 |
| Molecular Formula | C10H13ClFNO3S |
| Molecular Weight | 281.74 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | 5-chloro-2-fluoro-N-(3-methoxypropyl)benzenesulfonamide |
| SMILES | COCCCNS(=O)(=O)c1cc(Cl)ccc1F |
| InChI | InChI=1S/C10H13ClFNO3S/c1-16-6-2-5-13-17(14,15)10-7-8(11)3-4-9(10)12/h3-4,7,13H,2,5-6H2,1H3 |
| InChIKey | YNCYWKCRUYXIOW-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.74 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|