C15H14Cl2FNO4S — CID 113103026
5-chloro-N-[2-(2-chloro-4-fluorophenoxy)ethyl]-2-methoxybenzenesulfonamide (PubChem CID 113103026) has the molecular formula C15H14Cl2FNO4S and a molecular weight of 394.25 g/mol. Its IUPAC name is 5-chloro-N-[2-(2-chloro-4-fluorophenoxy)ethyl]-2-methoxybenzenesulfonamide.
| Compound Name | 5-chloro-N-[2-(2-chloro-4-fluorophenoxy)ethyl]-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 113103026 |
| Molecular Formula | C15H14Cl2FNO4S |
| Molecular Weight | 394.25 g/mol |
| Exact Mass | 393.00 |
| IUPAC Name | 5-chloro-N-[2-(2-chloro-4-fluorophenoxy)ethyl]-2-methoxybenzenesulfonamide |
| SMILES | COc1ccc(Cl)cc1S(=O)(=O)NCCOc1ccc(F)cc1Cl |
| InChI | InChI=1S/C15H14Cl2FNO4S/c1-22-14-4-2-10(16)8-15(14)24(20,21)19-6-7-23-13-5-3-11(18)9-12(13)17/h2-5,8-9,19H,6-7H2,1H3 |
| InChIKey | KDZUOVFPUNXECH-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.25 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|