C17H16FN3O4S2 — CID 41246978
5-fluoro-2-methoxy-N-[2-(6-thiophen-2-ylpyridazin-3-yl)oxyethyl]benzenesulfonamide (PubChem CID 41246978) has the molecular formula C17H16FN3O4S2 and a molecular weight of 409.46 g/mol. Its IUPAC name is 5-fluoro-2-methoxy-N-[2-(6-thiophen-2-ylpyridazin-3-yl)oxyethyl]benzenesulfonamide.
| Compound Name | 5-fluoro-2-methoxy-N-[2-(6-thiophen-2-ylpyridazin-3-yl)oxyethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 41246978 |
| Molecular Formula | C17H16FN3O4S2 |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.06 |
| IUPAC Name | 5-fluoro-2-methoxy-N-[2-(6-thiophen-2-ylpyridazin-3-yl)oxyethyl]benzenesulfonamide |
| SMILES | COc1ccc(F)cc1S(=O)(=O)NCCOc1ccc(-c2cccs2)nn1 |
| InChI | InChI=1S/C17H16FN3O4S2/c1-24-14-6-4-12(18)11-16(14)27(22,23)19-8-9-25-17-7-5-13(20-21-17)15-3-2-10-26-15/h2-7,10-11,19H,8-9H2,1H3 |
| InChIKey | WGIMPGRSVQPXJY-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|