C17H14F3N3O4S2 — CID 41247052
N-[2-(6-thiophen-2-ylpyridazin-3-yl)oxyethyl]-4-(trifluoromethoxy)benzenesulfonamide (PubChem CID 41247052) has the molecular formula C17H14F3N3O4S2 and a molecular weight of 445.44 g/mol. Its IUPAC name is N-[2-(6-thiophen-2-ylpyridazin-3-yl)oxyethyl]-4-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-[2-(6-thiophen-2-ylpyridazin-3-yl)oxyethyl]-4-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 41247052 |
| Molecular Formula | C17H14F3N3O4S2 |
| Molecular Weight | 445.44 g/mol |
| Exact Mass | 445.04 |
| IUPAC Name | N-[2-(6-thiophen-2-ylpyridazin-3-yl)oxyethyl]-4-(trifluoromethoxy)benzenesulfonamide |
| SMILES | O=S(=O)(NCCOc1ccc(-c2cccs2)nn1)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H14F3N3O4S2/c18-17(19,20)27-12-3-5-13(6-4-12)29(24,25)21-9-10-26-16-8-7-14(22-23-16)15-2-1-11-28-15/h1-8,11,21H,9-10H2 |
| InChIKey | TVMBHPYDZDCGRW-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.44 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|