C16H14FN3O3S2 — CID 41246988
3-fluoro-N-[2-(6-thiophen-2-ylpyridazin-3-yl)oxyethyl]benzenesulfonamide (PubChem CID 41246988) has the molecular formula C16H14FN3O3S2 and a molecular weight of 379.44 g/mol. Its IUPAC name is 3-fluoro-N-[2-(6-thiophen-2-ylpyridazin-3-yl)oxyethyl]benzenesulfonamide.
| Compound Name | 3-fluoro-N-[2-(6-thiophen-2-ylpyridazin-3-yl)oxyethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 41246988 |
| Molecular Formula | C16H14FN3O3S2 |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | 3-fluoro-N-[2-(6-thiophen-2-ylpyridazin-3-yl)oxyethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCOc1ccc(-c2cccs2)nn1)c1cccc(F)c1 |
| InChI | InChI=1S/C16H14FN3O3S2/c17-12-3-1-4-13(11-12)25(21,22)18-8-9-23-16-7-6-14(19-20-16)15-5-2-10-24-15/h1-7,10-11,18H,8-9H2 |
| InChIKey | FIFSXABEJFMRFZ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|