C17H14F3N3O3S2 — CID 41247032
N-[2-(6-thiophen-2-ylpyridazin-3-yl)oxyethyl]-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 41247032) has the molecular formula C17H14F3N3O3S2 and a molecular weight of 429.45 g/mol. Its IUPAC name is N-[2-(6-thiophen-2-ylpyridazin-3-yl)oxyethyl]-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[2-(6-thiophen-2-ylpyridazin-3-yl)oxyethyl]-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 41247032 |
| Molecular Formula | C17H14F3N3O3S2 |
| Molecular Weight | 429.45 g/mol |
| Exact Mass | 429.04 |
| IUPAC Name | N-[2-(6-thiophen-2-ylpyridazin-3-yl)oxyethyl]-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCCOc1ccc(-c2cccs2)nn1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H14F3N3O3S2/c18-17(19,20)12-3-1-4-13(11-12)28(24,25)21-8-9-26-16-7-6-14(22-23-16)15-5-2-10-27-15/h1-7,10-11,21H,8-9H2 |
| InChIKey | FXRHPZINBGNEHD-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.45 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|