C15H14N4O3S2 — CID 41247021
N-[2-(6-thiophen-2-ylpyridazin-3-yl)oxyethyl]pyridine-3-sulfonamide (PubChem CID 41247021) has the molecular formula C15H14N4O3S2 and a molecular weight of 362.44 g/mol. Its IUPAC name is N-[2-(6-thiophen-2-ylpyridazin-3-yl)oxyethyl]pyridine-3-sulfonamide.
| Compound Name | N-[2-(6-thiophen-2-ylpyridazin-3-yl)oxyethyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 41247021 |
| Molecular Formula | C15H14N4O3S2 |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | N-[2-(6-thiophen-2-ylpyridazin-3-yl)oxyethyl]pyridine-3-sulfonamide |
| SMILES | O=S(=O)(NCCOc1ccc(-c2cccs2)nn1)c1cccnc1 |
| InChI | InChI=1S/C15H14N4O3S2/c20-24(21,12-3-1-7-16-11-12)17-8-9-22-15-6-5-13(18-19-15)14-4-2-10-23-14/h1-7,10-11,17H,8-9H2 |
| InChIKey | YGGFAQIEWQKRSN-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 94.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|