C14H12ClN3O3S3 — CID 41247027
5-chloro-N-[2-(6-thiophen-2-ylpyridazin-3-yl)oxyethyl]thiophene-2-sulfonamide (PubChem CID 41247027) has the molecular formula C14H12ClN3O3S3 and a molecular weight of 401.92 g/mol. Its IUPAC name is 5-chloro-N-[2-(6-thiophen-2-ylpyridazin-3-yl)oxyethyl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[2-(6-thiophen-2-ylpyridazin-3-yl)oxyethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 41247027 |
| Molecular Formula | C14H12ClN3O3S3 |
| Molecular Weight | 401.92 g/mol |
| Exact Mass | 400.97 |
| IUPAC Name | 5-chloro-N-[2-(6-thiophen-2-ylpyridazin-3-yl)oxyethyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NCCOc1ccc(-c2cccs2)nn1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C14H12ClN3O3S3/c15-12-4-6-14(23-12)24(19,20)16-7-8-21-13-5-3-10(17-18-13)11-2-1-9-22-11/h1-6,9,16H,7-8H2 |
| InChIKey | DPHSKHYYTZUOJN-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.92 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|