C14H14ClN3O2S3 — CID 71797224
5-chloro-N-[2-(1-methyl-4-thiophen-2-ylimidazol-2-yl)ethyl]thiophene-2-sulfonamide (PubChem CID 71797224) has the molecular formula C14H14ClN3O2S3 and a molecular weight of 387.94 g/mol. Its IUPAC name is 5-chloro-N-[2-(1-methyl-4-thiophen-2-ylimidazol-2-yl)ethyl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[2-(1-methyl-4-thiophen-2-ylimidazol-2-yl)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 71797224 |
| Molecular Formula | C14H14ClN3O2S3 |
| Molecular Weight | 387.94 g/mol |
| Exact Mass | 386.99 |
| IUPAC Name | 5-chloro-N-[2-(1-methyl-4-thiophen-2-ylimidazol-2-yl)ethyl]thiophene-2-sulfonamide |
| SMILES | Cn1cc(-c2cccs2)nc1CCNS(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C14H14ClN3O2S3/c1-18-9-10(11-3-2-8-21-11)17-13(18)6-7-16-23(19,20)14-5-4-12(15)22-14/h2-5,8-9,16H,6-7H2,1H3 |
| InChIKey | ZPHSOYGLPGGWKE-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.94 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |