C14H16ClNO5S2 — CID 113101998
5-chloro-N-[2-(2,3-dimethoxyphenoxy)ethyl]thiophene-2-sulfonamide (PubChem CID 113101998) has the molecular formula C14H16ClNO5S2 and a molecular weight of 377.87 g/mol. Its IUPAC name is 5-chloro-N-[2-(2,3-dimethoxyphenoxy)ethyl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[2-(2,3-dimethoxyphenoxy)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 113101998 |
| Molecular Formula | C14H16ClNO5S2 |
| Molecular Weight | 377.87 g/mol |
| Exact Mass | 377.02 |
| IUPAC Name | 5-chloro-N-[2-(2,3-dimethoxyphenoxy)ethyl]thiophene-2-sulfonamide |
| SMILES | COc1cccc(OCCNS(=O)(=O)c2ccc(Cl)s2)c1OC |
| InChI | InChI=1S/C14H16ClNO5S2/c1-19-10-4-3-5-11(14(10)20-2)21-9-8-16-23(17,18)13-7-6-12(15)22-13/h3-7,16H,8-9H2,1-2H3 |
| InChIKey | PKRPPIVZFDBFKD-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.87 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|