C18H20N2O6S — CID 113102003
N-[2-(2,3-dimethoxyphenoxy)ethyl]-2-oxo-1,3-dihydroindole-5-sulfonamide (PubChem CID 113102003) has the molecular formula C18H20N2O6S and a molecular weight of 392.43 g/mol. Its IUPAC name is N-[2-(2,3-dimethoxyphenoxy)ethyl]-2-oxo-1,3-dihydroindole-5-sulfonamide.
| Compound Name | N-[2-(2,3-dimethoxyphenoxy)ethyl]-2-oxo-1,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 113102003 |
| Molecular Formula | C18H20N2O6S |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | N-[2-(2,3-dimethoxyphenoxy)ethyl]-2-oxo-1,3-dihydroindole-5-sulfonamide |
| SMILES | COc1cccc(OCCNS(=O)(=O)c2ccc3c(c2)CC(=O)N3)c1OC |
| InChI | InChI=1S/C18H20N2O6S/c1-24-15-4-3-5-16(18(15)25-2)26-9-8-19-27(22,23)13-6-7-14-12(10-13)11-17(21)20-14/h3-7,10,19H,8-9,11H2,1-2H3,(H,20,21) |
| InChIKey | JZFFOHQKXNTEAK-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|