C21H20F3N3O4S — CID 41246550
N-[2-[6-(4-ethoxyphenyl)pyridazin-3-yl]oxyethyl]-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 41246550) has the molecular formula C21H20F3N3O4S and a molecular weight of 467.47 g/mol. Its IUPAC name is N-[2-[6-(4-ethoxyphenyl)pyridazin-3-yl]oxyethyl]-4-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[2-[6-(4-ethoxyphenyl)pyridazin-3-yl]oxyethyl]-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 41246550 |
| Molecular Formula | C21H20F3N3O4S |
| Molecular Weight | 467.47 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | N-[2-[6-(4-ethoxyphenyl)pyridazin-3-yl]oxyethyl]-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | CCOc1ccc(-c2ccc(OCCNS(=O)(=O)c3ccc(C(F)(F)F)cc3)nn2)cc1 |
| InChI | InChI=1S/C21H20F3N3O4S/c1-2-30-17-7-3-15(4-8-17)19-11-12-20(27-26-19)31-14-13-25-32(28,29)18-9-5-16(6-10-18)21(22,23)24/h3-12,25H,2,13-14H2,1H3 |
| InChIKey | RTDSKWRHBMNAAG-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.47 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|