C11H14BrF2NO2S — CID 106135621
N-(4-bromopentyl)-2,5-difluorobenzenesulfonamide (PubChem CID 106135621) has the molecular formula C11H14BrF2NO2S and a molecular weight of 342.21 g/mol. Its IUPAC name is N-(4-bromopentyl)-2,5-difluorobenzenesulfonamide.
| Compound Name | N-(4-bromopentyl)-2,5-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 106135621 |
| Molecular Formula | C11H14BrF2NO2S |
| Molecular Weight | 342.21 g/mol |
| Exact Mass | 340.99 |
| IUPAC Name | N-(4-bromopentyl)-2,5-difluorobenzenesulfonamide |
| SMILES | CC(Br)CCCNS(=O)(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C11H14BrF2NO2S/c1-8(12)3-2-6-15-18(16,17)11-7-9(13)4-5-10(11)14/h4-5,7-8,15H,2-3,6H2,1H3 |
| InChIKey | UZWQYTXGBCKDBN-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.21 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|