C14H22F2N2O2S — CID 78808057
N-[2-[di(propan-2-yl)amino]ethyl]-2,5-difluorobenzenesulfonamide (PubChem CID 78808057) has the molecular formula C14H22F2N2O2S and a molecular weight of 320.41 g/mol. Its IUPAC name is N-[2-[di(propan-2-yl)amino]ethyl]-2,5-difluorobenzenesulfonamide.
| Compound Name | N-[2-[di(propan-2-yl)amino]ethyl]-2,5-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 78808057 |
| Molecular Formula | C14H22F2N2O2S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | N-[2-[di(propan-2-yl)amino]ethyl]-2,5-difluorobenzenesulfonamide |
| SMILES | CC(C)N(CCNS(=O)(=O)c1cc(F)ccc1F)C(C)C |
| InChI | InChI=1S/C14H22F2N2O2S/c1-10(2)18(11(3)4)8-7-17-21(19,20)14-9-12(15)5-6-13(14)16/h5-6,9-11,17H,7-8H2,1-4H3 |
| InChIKey | XXLXRBBTZUEEAA-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |