C12H16F3NO2S2 — CID 3682594
N-(2-tert-butylsulfanylethyl)-2,3,4-trifluorobenzenesulfonamide (PubChem CID 3682594) has the molecular formula C12H16F3NO2S2 and a molecular weight of 327.39 g/mol. Its IUPAC name is N-(2-tert-butylsulfanylethyl)-2,3,4-trifluorobenzenesulfonamide.
| Compound Name | N-(2-tert-butylsulfanylethyl)-2,3,4-trifluorobenzenesulfonamide |
|---|---|
| PubChem CID | 3682594 |
| Molecular Formula | C12H16F3NO2S2 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | N-(2-tert-butylsulfanylethyl)-2,3,4-trifluorobenzenesulfonamide |
| SMILES | CC(C)(C)SCCNS(=O)(=O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C12H16F3NO2S2/c1-12(2,3)19-7-6-16-20(17,18)9-5-4-8(13)10(14)11(9)15/h4-5,16H,6-7H2,1-3H3 |
| InChIKey | MRFXVSIYISPUKY-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|