C15H11F6NO2S — CID 3813210
2,3,4-trifluoro-N-[2-[3-(trifluoromethyl)phenyl]ethyl]benzenesulfonamide (PubChem CID 3813210) has the molecular formula C15H11F6NO2S and a molecular weight of 383.31 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-[2-[3-(trifluoromethyl)phenyl]ethyl]benzenesulfonamide.
| Compound Name | 2,3,4-trifluoro-N-[2-[3-(trifluoromethyl)phenyl]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 3813210 |
| Molecular Formula | C15H11F6NO2S |
| Molecular Weight | 383.31 g/mol |
| Exact Mass | 383.04 |
| IUPAC Name | 2,3,4-trifluoro-N-[2-[3-(trifluoromethyl)phenyl]ethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCc1cccc(C(F)(F)F)c1)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C15H11F6NO2S/c16-11-4-5-12(14(18)13(11)17)25(23,24)22-7-6-9-2-1-3-10(8-9)15(19,20)21/h1-5,8,22H,6-7H2 |
| InChIKey | QXPKVMOIDCZJDE-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.31 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|