C13H20F3NSi — CID 67402200
2-[3-(trifluoromethyl)phenyl]-N-(trimethylsilylmethyl)ethanamine (PubChem CID 67402200) has the molecular formula C13H20F3NSi and a molecular weight of 275.39 g/mol. Its IUPAC name is 2-[3-(trifluoromethyl)phenyl]-N-(trimethylsilylmethyl)ethanamine.
| Compound Name | 2-[3-(trifluoromethyl)phenyl]-N-(trimethylsilylmethyl)ethanamine |
|---|---|
| PubChem CID | 67402200 |
| Molecular Formula | C13H20F3NSi |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 2-[3-(trifluoromethyl)phenyl]-N-(trimethylsilylmethyl)ethanamine |
| SMILES | C[Si](C)(C)CNCCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H20F3NSi/c1-18(2,3)10-17-8-7-11-5-4-6-12(9-11)13(14,15)16/h4-6,9,17H,7-8,10H2,1-3H3 |
| InChIKey | ZDSUNLWFGVSTKN-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|