C19H20F3NO2 — CID 69346752
N-[(2,2-dimethyl-1,3-benzodioxol-5-yl)methyl]-2-[3-(trifluoromethyl)phenyl]ethanamine (PubChem CID 69346752) has the molecular formula C19H20F3NO2 and a molecular weight of 351.37 g/mol. Its IUPAC name is N-[(2,2-dimethyl-1,3-benzodioxol-5-yl)methyl]-2-[3-(trifluoromethyl)phenyl]ethanamine.
| Compound Name | N-[(2,2-dimethyl-1,3-benzodioxol-5-yl)methyl]-2-[3-(trifluoromethyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 69346752 |
| Molecular Formula | C19H20F3NO2 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | N-[(2,2-dimethyl-1,3-benzodioxol-5-yl)methyl]-2-[3-(trifluoromethyl)phenyl]ethanamine |
| SMILES | CC1(C)Oc2ccc(CNCCc3cccc(C(F)(F)F)c3)cc2O1 |
| InChI | InChI=1S/C19H20F3NO2/c1-18(2)24-16-7-6-14(11-17(16)25-18)12-23-9-8-13-4-3-5-15(10-13)19(20,21)22/h3-7,10-11,23H,8-9,12H2,1-2H3 |
| InChIKey | DKEHYWNOOIUXTO-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|