C20H23ClF3NO — CID 69342163
N-[[3-chloro-4-(2-methoxypropan-2-yl)phenyl]methyl]-2-[3-(trifluoromethyl)phenyl]ethanamine (PubChem CID 69342163) has the molecular formula C20H23ClF3NO and a molecular weight of 385.86 g/mol. Its IUPAC name is N-[[3-chloro-4-(2-methoxypropan-2-yl)phenyl]methyl]-2-[3-(trifluoromethyl)phenyl]ethanamine.
| Compound Name | N-[[3-chloro-4-(2-methoxypropan-2-yl)phenyl]methyl]-2-[3-(trifluoromethyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 69342163 |
| Molecular Formula | C20H23ClF3NO |
| Molecular Weight | 385.86 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | N-[[3-chloro-4-(2-methoxypropan-2-yl)phenyl]methyl]-2-[3-(trifluoromethyl)phenyl]ethanamine |
| SMILES | COC(C)(C)c1ccc(CNCCc2cccc(C(F)(F)F)c2)cc1Cl |
| InChI | InChI=1S/C20H23ClF3NO/c1-19(2,26-3)17-8-7-15(12-18(17)21)13-25-10-9-14-5-4-6-16(11-14)20(22,23)24/h4-8,11-12,25H,9-10,13H2,1-3H3 |
| InChIKey | JVMODQNAJPLYFP-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.86 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|