C23H29F3N2O2S — CID 91425656
N-[[3-(3,3-dimethylpiperidin-1-yl)sulfonylphenyl]methyl]-2-[3-(trifluoromethyl)phenyl]ethanamine (PubChem CID 91425656) has the molecular formula C23H29F3N2O2S and a molecular weight of 454.56 g/mol. Its IUPAC name is N-[[3-(3,3-dimethylpiperidin-1-yl)sulfonylphenyl]methyl]-2-[3-(trifluoromethyl)phenyl]ethanamine.
| Compound Name | N-[[3-(3,3-dimethylpiperidin-1-yl)sulfonylphenyl]methyl]-2-[3-(trifluoromethyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 91425656 |
| Molecular Formula | C23H29F3N2O2S |
| Molecular Weight | 454.56 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | N-[[3-(3,3-dimethylpiperidin-1-yl)sulfonylphenyl]methyl]-2-[3-(trifluoromethyl)phenyl]ethanamine |
| SMILES | CC1(C)CCCN(S(=O)(=O)c2cccc(CNCCc3cccc(C(F)(F)F)c3)c2)C1 |
| InChI | InChI=1S/C23H29F3N2O2S/c1-22(2)11-5-13-28(17-22)31(29,30)21-9-4-7-19(15-21)16-27-12-10-18-6-3-8-20(14-18)23(24,25)26/h3-4,6-9,14-15,27H,5,10-13,16-17H2,1-2H3 |
| InChIKey | NPUCMIJEWAHYLO-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.56 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|