C13H23NO5S — CID 106014493
5-(hydroxymethyl)-2-methyl-N-(4-propan-2-yloxybutyl)furan-3-sulfonamide (PubChem CID 106014493) has the molecular formula C13H23NO5S and a molecular weight of 305.40 g/mol. Its IUPAC name is 5-(hydroxymethyl)-2-methyl-N-(4-propan-2-yloxybutyl)furan-3-sulfonamide.
| Compound Name | 5-(hydroxymethyl)-2-methyl-N-(4-propan-2-yloxybutyl)furan-3-sulfonamide |
|---|---|
| PubChem CID | 106014493 |
| Molecular Formula | C13H23NO5S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 5-(hydroxymethyl)-2-methyl-N-(4-propan-2-yloxybutyl)furan-3-sulfonamide |
| SMILES | Cc1oc(CO)cc1S(=O)(=O)NCCCCOC(C)C |
| InChI | InChI=1S/C13H23NO5S/c1-10(2)18-7-5-4-6-14-20(16,17)13-8-12(9-15)19-11(13)3/h8,10,14-15H,4-7,9H2,1-3H3 |
| InChIKey | JLOMAMDHCGFEJQ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|