C11H19NO5S — CID 114133466
N-(3-ethoxypropyl)-5-(hydroxymethyl)-2-methylfuran-3-sulfonamide (PubChem CID 114133466) has the molecular formula C11H19NO5S and a molecular weight of 277.34 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-5-(hydroxymethyl)-2-methylfuran-3-sulfonamide.
| Compound Name | N-(3-ethoxypropyl)-5-(hydroxymethyl)-2-methylfuran-3-sulfonamide |
|---|---|
| PubChem CID | 114133466 |
| Molecular Formula | C11H19NO5S |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | N-(3-ethoxypropyl)-5-(hydroxymethyl)-2-methylfuran-3-sulfonamide |
| SMILES | CCOCCCNS(=O)(=O)c1cc(CO)oc1C |
| InChI | InChI=1S/C11H19NO5S/c1-3-16-6-4-5-12-18(14,15)11-7-10(8-13)17-9(11)2/h7,12-13H,3-6,8H2,1-2H3 |
| InChIKey | DWTQRQYWRLNBTO-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|