C10H15F2NO5S — CID 106001563
N-[2-(2,2-difluoroethoxy)ethyl]-5-(hydroxymethyl)-2-methylfuran-3-sulfonamide (PubChem CID 106001563) has the molecular formula C10H15F2NO5S and a molecular weight of 299.30 g/mol. Its IUPAC name is N-[2-(2,2-difluoroethoxy)ethyl]-5-(hydroxymethyl)-2-methylfuran-3-sulfonamide.
| Compound Name | N-[2-(2,2-difluoroethoxy)ethyl]-5-(hydroxymethyl)-2-methylfuran-3-sulfonamide |
|---|---|
| PubChem CID | 106001563 |
| Molecular Formula | C10H15F2NO5S |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | N-[2-(2,2-difluoroethoxy)ethyl]-5-(hydroxymethyl)-2-methylfuran-3-sulfonamide |
| SMILES | Cc1oc(CO)cc1S(=O)(=O)NCCOCC(F)F |
| InChI | InChI=1S/C10H15F2NO5S/c1-7-9(4-8(5-14)18-7)19(15,16)13-2-3-17-6-10(11)12/h4,10,13-14H,2-3,5-6H2,1H3 |
| InChIKey | HPJDPKRHHYNYEL-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|