C11H15F2NO4S — CID 106001506
N-[2-(2,2-difluoroethoxy)ethyl]-4-(hydroxymethyl)benzenesulfonamide (PubChem CID 106001506) has the molecular formula C11H15F2NO4S and a molecular weight of 295.31 g/mol. Its IUPAC name is N-[2-(2,2-difluoroethoxy)ethyl]-4-(hydroxymethyl)benzenesulfonamide.
| Compound Name | N-[2-(2,2-difluoroethoxy)ethyl]-4-(hydroxymethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106001506 |
| Molecular Formula | C11H15F2NO4S |
| Molecular Weight | 295.31 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | N-[2-(2,2-difluoroethoxy)ethyl]-4-(hydroxymethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCCOCC(F)F)c1ccc(CO)cc1 |
| InChI | InChI=1S/C11H15F2NO4S/c12-11(13)8-18-6-5-14-19(16,17)10-3-1-9(7-15)2-4-10/h1-4,11,14-15H,5-8H2 |
| InChIKey | YFUKJSKGSKWYHU-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.31 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|