C11H15BrF2N2O3S — CID 106091823
4-(aminomethyl)-2-bromo-N-[2-(2,2-difluoroethoxy)ethyl]benzenesulfonamide (PubChem CID 106091823) has the molecular formula C11H15BrF2N2O3S and a molecular weight of 373.22 g/mol. Its IUPAC name is 4-(aminomethyl)-2-bromo-N-[2-(2,2-difluoroethoxy)ethyl]benzenesulfonamide.
| Compound Name | 4-(aminomethyl)-2-bromo-N-[2-(2,2-difluoroethoxy)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106091823 |
| Molecular Formula | C11H15BrF2N2O3S |
| Molecular Weight | 373.22 g/mol |
| Exact Mass | 372.00 |
| IUPAC Name | 4-(aminomethyl)-2-bromo-N-[2-(2,2-difluoroethoxy)ethyl]benzenesulfonamide |
| SMILES | NCc1ccc(S(=O)(=O)NCCOCC(F)F)c(Br)c1 |
| InChI | InChI=1S/C11H15BrF2N2O3S/c12-9-5-8(6-15)1-2-10(9)20(17,18)16-3-4-19-7-11(13)14/h1-2,5,11,16H,3-4,6-7,15H2 |
| InChIKey | PHBGYYWKCOCSDI-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.22 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|