C14H24BrN3O2S — CID 106094270
4-(aminomethyl)-2-bromo-N-[2-[butan-2-yl(methyl)amino]ethyl]benzenesulfonamide (PubChem CID 106094270) has the molecular formula C14H24BrN3O2S and a molecular weight of 378.34 g/mol. Its IUPAC name is 4-(aminomethyl)-2-bromo-N-[2-[butan-2-yl(methyl)amino]ethyl]benzenesulfonamide.
| Compound Name | 4-(aminomethyl)-2-bromo-N-[2-[butan-2-yl(methyl)amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106094270 |
| Molecular Formula | C14H24BrN3O2S |
| Molecular Weight | 378.34 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | 4-(aminomethyl)-2-bromo-N-[2-[butan-2-yl(methyl)amino]ethyl]benzenesulfonamide |
| SMILES | CCC(C)N(C)CCNS(=O)(=O)c1ccc(CN)cc1Br |
| InChI | InChI=1S/C14H24BrN3O2S/c1-4-11(2)18(3)8-7-17-21(19,20)14-6-5-12(10-16)9-13(14)15/h5-6,9,11,17H,4,7-8,10,16H2,1-3H3 |
| InChIKey | SAJPLUVLZVLTJS-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.34 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |