C12H19FN2O4S — CID 106051244
4-(aminomethyl)-2-fluoro-N-[2-(2-methoxyethoxy)ethyl]benzenesulfonamide (PubChem CID 106051244) has the molecular formula C12H19FN2O4S and a molecular weight of 306.36 g/mol. Its IUPAC name is 4-(aminomethyl)-2-fluoro-N-[2-(2-methoxyethoxy)ethyl]benzenesulfonamide.
| Compound Name | 4-(aminomethyl)-2-fluoro-N-[2-(2-methoxyethoxy)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106051244 |
| Molecular Formula | C12H19FN2O4S |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 4-(aminomethyl)-2-fluoro-N-[2-(2-methoxyethoxy)ethyl]benzenesulfonamide |
| SMILES | COCCOCCNS(=O)(=O)c1ccc(CN)cc1F |
| InChI | InChI=1S/C12H19FN2O4S/c1-18-6-7-19-5-4-15-20(16,17)12-3-2-10(9-14)8-11(12)13/h2-3,8,15H,4-7,9,14H2,1H3 |
| InChIKey | ZUDUYVBCSFBMIT-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|