C13H21FN2O3S — CID 106053966
5-(aminomethyl)-3-fluoro-N-(4-methoxybutyl)-2-methylbenzenesulfonamide (PubChem CID 106053966) has the molecular formula C13H21FN2O3S and a molecular weight of 304.39 g/mol. Its IUPAC name is 5-(aminomethyl)-3-fluoro-N-(4-methoxybutyl)-2-methylbenzenesulfonamide.
| Compound Name | 5-(aminomethyl)-3-fluoro-N-(4-methoxybutyl)-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 106053966 |
| Molecular Formula | C13H21FN2O3S |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 5-(aminomethyl)-3-fluoro-N-(4-methoxybutyl)-2-methylbenzenesulfonamide |
| SMILES | COCCCCNS(=O)(=O)c1cc(CN)cc(F)c1C |
| InChI | InChI=1S/C13H21FN2O3S/c1-10-12(14)7-11(9-15)8-13(10)20(17,18)16-5-3-4-6-19-2/h7-8,16H,3-6,9,15H2,1-2H3 |
| InChIKey | DIKNODXVCJMXOK-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|