C13H19F2NO4S — CID 106002047
2,3-difluoro-5-(hydroxymethyl)-N-(5-methoxypentyl)benzenesulfonamide (PubChem CID 106002047) has the molecular formula C13H19F2NO4S and a molecular weight of 323.36 g/mol. Its IUPAC name is 2,3-difluoro-5-(hydroxymethyl)-N-(5-methoxypentyl)benzenesulfonamide.
| Compound Name | 2,3-difluoro-5-(hydroxymethyl)-N-(5-methoxypentyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106002047 |
| Molecular Formula | C13H19F2NO4S |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 2,3-difluoro-5-(hydroxymethyl)-N-(5-methoxypentyl)benzenesulfonamide |
| SMILES | COCCCCCNS(=O)(=O)c1cc(CO)cc(F)c1F |
| InChI | InChI=1S/C13H19F2NO4S/c1-20-6-4-2-3-5-16-21(18,19)12-8-10(9-17)7-11(14)13(12)15/h7-8,16-17H,2-6,9H2,1H3 |
| InChIKey | CHLGVQXUASTMOW-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|