C14H22F2N2O2S — CID 105120214
N-butyl-2,3-difluoro-5-(propylaminomethyl)benzenesulfonamide (PubChem CID 105120214) has the molecular formula C14H22F2N2O2S and a molecular weight of 320.41 g/mol. Its IUPAC name is N-butyl-2,3-difluoro-5-(propylaminomethyl)benzenesulfonamide.
| Compound Name | N-butyl-2,3-difluoro-5-(propylaminomethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 105120214 |
| Molecular Formula | C14H22F2N2O2S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | N-butyl-2,3-difluoro-5-(propylaminomethyl)benzenesulfonamide |
| SMILES | CCCCNS(=O)(=O)c1cc(CNCCC)cc(F)c1F |
| InChI | InChI=1S/C14H22F2N2O2S/c1-3-5-7-18-21(19,20)13-9-11(10-17-6-4-2)8-12(15)14(13)16/h8-9,17-18H,3-7,10H2,1-2H3 |
| InChIKey | NVQAELVCVYTLLK-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|