C10H14F2N2O2S — CID 105120228
2,3-difluoro-5-(propylaminomethyl)benzenesulfonamide (PubChem CID 105120228) has the molecular formula C10H14F2N2O2S and a molecular weight of 264.30 g/mol. Its IUPAC name is 2,3-difluoro-5-(propylaminomethyl)benzenesulfonamide.
| Compound Name | 2,3-difluoro-5-(propylaminomethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 105120228 |
| Molecular Formula | C10H14F2N2O2S |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 2,3-difluoro-5-(propylaminomethyl)benzenesulfonamide |
| SMILES | CCCNCc1cc(F)c(F)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C10H14F2N2O2S/c1-2-3-14-6-7-4-8(11)10(12)9(5-7)17(13,15)16/h4-5,14H,2-3,6H2,1H3,(H2,13,15,16) |
| InChIKey | VPRWBVUNQLVWNE-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|