C22H32N2O3S — CID 71388033
2-benzyl-3-butoxy-5-(butylaminomethyl)benzenesulfonamide (PubChem CID 71388033) has the molecular formula C22H32N2O3S and a molecular weight of 404.58 g/mol. Its IUPAC name is 2-benzyl-3-butoxy-5-(butylaminomethyl)benzenesulfonamide.
| Compound Name | 2-benzyl-3-butoxy-5-(butylaminomethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 71388033 |
| Molecular Formula | C22H32N2O3S |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | 2-benzyl-3-butoxy-5-(butylaminomethyl)benzenesulfonamide |
| SMILES | CCCCNCc1cc(OCCCC)c(Cc2ccccc2)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C22H32N2O3S/c1-3-5-12-24-17-19-15-21(27-13-6-4-2)20(22(16-19)28(23,25)26)14-18-10-8-7-9-11-18/h7-11,15-16,24H,3-6,12-14,17H2,1-2H3,(H2,23,25,26) |
| InChIKey | IRBRSHCGIKUBTA-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|