C21H19NO5S — CID 21440164
4-benzyl-3-phenylmethoxy-5-sulfamoylbenzoic acid (PubChem CID 21440164) has the molecular formula C21H19NO5S and a molecular weight of 397.45 g/mol. Its IUPAC name is 4-benzyl-3-phenylmethoxy-5-sulfamoylbenzoic acid.
| Compound Name | 4-benzyl-3-phenylmethoxy-5-sulfamoylbenzoic acid |
|---|---|
| PubChem CID | 21440164 |
| Molecular Formula | C21H19NO5S |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 4-benzyl-3-phenylmethoxy-5-sulfamoylbenzoic acid |
| SMILES | NS(=O)(=O)c1cc(C(=O)O)cc(OCc2ccccc2)c1Cc1ccccc1 |
| InChI | InChI=1S/C21H19NO5S/c22-28(25,26)20-13-17(21(23)24)12-19(27-14-16-9-5-2-6-10-16)18(20)11-15-7-3-1-4-8-15/h1-10,12-13H,11,14H2,(H,23,24)(H2,22,25,26) |
| InChIKey | WGDSJANRFVENBV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |