C18H21NO4S — CID 154132980
4-benzyl-3-butyl-5-sulfamoylbenzoic acid (PubChem CID 154132980) has the molecular formula C18H21NO4S and a molecular weight of 347.44 g/mol. Its IUPAC name is 4-benzyl-3-butyl-5-sulfamoylbenzoic acid.
| Compound Name | 4-benzyl-3-butyl-5-sulfamoylbenzoic acid |
|---|---|
| PubChem CID | 154132980 |
| Molecular Formula | C18H21NO4S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 4-benzyl-3-butyl-5-sulfamoylbenzoic acid |
| SMILES | CCCCc1cc(C(=O)O)cc(S(N)(=O)=O)c1Cc1ccccc1 |
| InChI | InChI=1S/C18H21NO4S/c1-2-3-9-14-11-15(18(20)21)12-17(24(19,22)23)16(14)10-13-7-5-4-6-8-13/h4-8,11-12H,2-3,9-10H2,1H3,(H,20,21)(H2,19,22,23) |
| InChIKey | LVBUJNCDSYAPTH-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |