C17H17Br2NO4S2 — CID 21440217
4-benzyl-3-(2,3-dibromopropylsulfanyl)-5-sulfamoylbenzoic acid (PubChem CID 21440217) has the molecular formula C17H17Br2NO4S2 and a molecular weight of 523.27 g/mol. Its IUPAC name is 4-benzyl-3-(2,3-dibromopropylsulfanyl)-5-sulfamoylbenzoic acid.
| Compound Name | 4-benzyl-3-(2,3-dibromopropylsulfanyl)-5-sulfamoylbenzoic acid |
|---|---|
| PubChem CID | 21440217 |
| Molecular Formula | C17H17Br2NO4S2 |
| Molecular Weight | 523.27 g/mol |
| Exact Mass | 520.90 |
| IUPAC Name | 4-benzyl-3-(2,3-dibromopropylsulfanyl)-5-sulfamoylbenzoic acid |
| SMILES | NS(=O)(=O)c1cc(C(=O)O)cc(SCC(Br)CBr)c1Cc1ccccc1 |
| InChI | InChI=1S/C17H17Br2NO4S2/c18-9-13(19)10-25-15-7-12(17(21)22)8-16(26(20,23)24)14(15)6-11-4-2-1-3-5-11/h1-5,7-8,13H,6,9-10H2,(H,21,22)(H2,20,23,24) |
| InChIKey | QTQLYANCMPGWKV-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.27 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|